C17H16N4O4 — CID 138392083
5-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 138392083) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 5-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138392083 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | CC1=C(/N=N/c2c(O)[nH]c(=O)[nH]c2=O)C(=O)C(c2ccccc2)C1C |
| InChI | InChI=1S/C17H16N4O4/c1-8-9(2)12(14(22)11(8)10-6-4-3-5-7-10)20-21-13-15(23)18-17(25)19-16(13)24/h3-8,11H,1-2H3,(H3,18,19,23,24,25)/b21-20+ |
| InChIKey | QDCMUGKHAAMQAL-QZQOTICOSA-N |
| XLogP | 2.13 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|