C17H25BF2N2O2 — CID 138392227
2-(4,4-difluoropiperidin-1-yl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 138392227) has the molecular formula C17H25BF2N2O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 138392227 |
| Molecular Formula | C17H25BF2N2O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cnc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H25BF2N2O2/c1-12-10-13(18-23-15(2,3)16(4,5)24-18)11-21-14(12)22-8-6-17(19,20)7-9-22/h10-11H,6-9H2,1-5H3 |
| InChIKey | IHWDTOLNSKZBOX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|