About 2-bromopyrrolo[2,3-e]indole
2-bromopyrrolo[2,3-e]indole (PubChem CID 138392253) has the molecular formula C10H5BrN2
and a molecular weight of 233.07 g/mol. Its IUPAC name is 2-bromopyrrolo[2,3-e]indole.
Molecular Properties
| Compound Name | 2-bromopyrrolo[2,3-e]indole |
| PubChem CID | 138392253 |
| Molecular Formula | C10H5BrN2 |
| Molecular Weight | 233.07 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 2-bromopyrrolo[2,3-e]indole |
| SMILES | BrC1=Nc2c3c(ccc2=C1)=NC=C3 |
| InChI | InChI=1S/C10H5BrN2/c11-9-5-6-1-2-8-7(3-4-12-8)10(6)13-9/h1-5H |
| InChIKey | DJFCOAFMGQTPJO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.07 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromopyrrolo[2,3-e]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopyrrolo[2,3-e]indole?
The IUPAC name of 2-bromopyrrolo[2,3-e]indole (CID 138392253) is 2-bromopyrrolo[2,3-e]indole.
What is the SMILES notation for 2-bromopyrrolo[2,3-e]indole?
The canonical SMILES for 2-bromopyrrolo[2,3-e]indole is BrC1=Nc2c3c(ccc2=C1)=NC=C3.
What is the InChIKey of 2-bromopyrrolo[2,3-e]indole?
The InChIKey is DJFCOAFMGQTPJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrN2/c11-9-5-6-1-2-8-7(3-4-12-8)10(6)13-9/h1-5H.
What are the key properties of 2-bromopyrrolo[2,3-e]indole?
2-bromopyrrolo[2,3-e]indole has a molecular weight of 233.07 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopyrrolo[2,3-e]indole is sourced from PubChem (CID 138392253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).