C16H14BrN5O2 — CID 138392404
4-(4-bromoanilino)-N-hydroxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 138392404) has the molecular formula C16H14BrN5O2 and a molecular weight of 388.23 g/mol. Its IUPAC name is 4-(4-bromoanilino)-N-hydroxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(4-bromoanilino)-N-hydroxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 138392404 |
| Molecular Formula | C16H14BrN5O2 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 4-(4-bromoanilino)-N-hydroxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1ccc(/N=C(\NO)c2nonc2Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H14BrN5O2/c1-10-2-6-12(7-3-10)18-15(20-23)14-16(22-24-21-14)19-13-8-4-11(17)5-9-13/h2-9,23H,1H3,(H,18,20)(H,19,22) |
| InChIKey | NCRUGQQTFHDMEV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|