C26H19N3O8S — CID 138392493
3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]propyl 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 138392493) has the molecular formula C26H19N3O8S and a molecular weight of 533.52 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]propyl 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | 3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]propyl 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 138392493 |
| Molecular Formula | C26H19N3O8S |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]propyl 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(OCCCOc1nonc1S(=O)(=O)c1ccccc1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H19N3O8S/c30-24-20-9-4-5-10-21(20)25(31)29(24)18-13-11-17(12-14-18)26(32)36-16-6-15-35-22-23(28-37-27-22)38(33,34)19-7-2-1-3-8-19/h1-5,7-14H,6,15-16H2 |
| InChIKey | DOHLSNAXTHALTP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 145.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|