About potassium 3-nitropyrazol-1-ide
potassium 3-nitropyrazol-1-ide (PubChem CID 138392530) has the molecular formula C3H2KN3O2
and a molecular weight of 151.17 g/mol. Its IUPAC name is potassium 3-nitropyrazol-1-ide.
Molecular Properties
| Compound Name | potassium 3-nitropyrazol-1-ide |
| PubChem CID | 138392530 |
| Molecular Formula | C3H2KN3O2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 150.98 |
| IUPAC Name | potassium 3-nitropyrazol-1-ide |
| SMILES | O=[N+]([O-])c1cc[n-]n1.[K+] |
| InChI | InChI=1S/C3H2N3O2.K/c7-6(8)3-1-2-4-5-3;/h1-2H;/q-1;+1 |
| InChIKey | AMRYZIZQJBMSJP-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-nitropyrazol-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-nitropyrazol-1-ide?
The IUPAC name of potassium 3-nitropyrazol-1-ide (CID 138392530) is potassium 3-nitropyrazol-1-ide.
What is the SMILES notation for potassium 3-nitropyrazol-1-ide?
The canonical SMILES for potassium 3-nitropyrazol-1-ide is O=[N+]([O-])c1cc[n-]n1.[K+].
What is the InChIKey of potassium 3-nitropyrazol-1-ide?
The InChIKey is AMRYZIZQJBMSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N3O2.K/c7-6(8)3-1-2-4-5-3;/h1-2H;/q-1;+1.
What are the key properties of potassium 3-nitropyrazol-1-ide?
potassium 3-nitropyrazol-1-ide has a molecular weight of 151.17 g/mol, XLogP of -3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-nitropyrazol-1-ide is sourced from PubChem (CID 138392530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).