C18H23N3O9P+ — CID 138393344
[(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxo-1H-pyrimido[4,5-b]quinolin-10-ium-10-yl)-2,3,4-trihydroxypentyl] dihydrogen phosphate (PubChem CID 138393344) has the molecular formula C18H23N3O9P+ and a molecular weight of 456.37 g/mol. Its IUPAC name is [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxo-1H-pyrimido[4,5-b]quinolin-10-ium-10-yl)-2,3,4-trihydroxypentyl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxo-1H-pyrimido[4,5-b]quinolin-10-ium-10-yl)-2,3,4-trihydroxypentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 138393344 |
| Molecular Formula | C18H23N3O9P+ |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxo-1H-pyrimido[4,5-b]quinolin-10-ium-10-yl)-2,3,4-trihydroxypentyl] dihydrogen phosphate |
| SMILES | Cc1cc2cc3c(=O)[nH]c(=O)[nH]c3[n+](C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)c2cc1C |
| InChI | InChI=1S/C18H22N3O9P/c1-8-3-10-5-11-16(19-18(26)20-17(11)25)21(12(10)4-9(8)2)6-13(22)15(24)14(23)7-30-31(27,28)29/h3-5,13-15,22-24H,6-7H2,1-2H3,(H3,20,25,26,27,28,29)/p+1/t13-,14+,15-/m0/s1 |
| InChIKey | QRLRYYXONWKHEI-ZNMIVQPWSA-O |
| XLogP | -1.53 |
| TPSA | 197.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|