C33H46ClNO2 — CID 138394067
4-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl-(3-oxo-3-phenylpropyl)amino]butan-2-one;hydrochloride (PubChem CID 138394067) has the molecular formula C33H46ClNO2 and a molecular weight of 524.19 g/mol. Its IUPAC name is 4-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl-(3-oxo-3-phenylpropyl)amino]butan-2-one;hydrochloride.
| Compound Name | 4-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl-(3-oxo-3-phenylpropyl)amino]butan-2-one;hydrochloride |
|---|---|
| PubChem CID | 138394067 |
| Molecular Formula | C33H46ClNO2 |
| Molecular Weight | 524.19 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 4-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl-(3-oxo-3-phenylpropyl)amino]butan-2-one;hydrochloride |
| SMILES | CC(=O)CCN(CCC(=O)c1ccccc1)C[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3CC[C@@H]12.Cl |
| InChI | InChI=1S/C33H45NO2.ClH/c1-24(2)27-12-14-29-28(22-27)13-15-31-32(4,18-9-19-33(29,31)5)23-34(20-16-25(3)35)21-17-30(36)26-10-7-6-8-11-26;/h6-8,10-12,14,22,24,31H,9,13,15-21,23H2,1-5H3;1H/t31-,32-,33+;/m0./s1 |
| InChIKey | NPMDWVGRYBJTDQ-WBAULYFBSA-N |
| XLogP | 7.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.19 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |