C16H30O13 — CID 138394257
(2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(2-hydroxyethoxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 138394257) has the molecular formula C16H30O13 and a molecular weight of 430.40 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(2-hydroxyethoxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(2-hydroxyethoxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 138394257 |
| Molecular Formula | C16H30O13 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(2-hydroxyethoxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | OCCOC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2COCCO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H30O13/c17-1-3-25-5-7-9(19)10(20)13(23)16(28-7)29-14-8(6-26-4-2-18)27-15(24)12(22)11(14)21/h7-24H,1-6H2/t7-,8-,9-,10+,11-,12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | KDMCKCKSBBHJKY-KPNIBBNDSA-N |
| XLogP | -5.36 |
| TPSA | 207.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|