C16H19F17NOS+ — CID 138394410
[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium (PubChem CID 138394410) has the molecular formula C16H19F17NOS+ and a molecular weight of 596.37 g/mol. Its IUPAC name is [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 138394410 |
| Molecular Formula | C16H19F17NOS+ |
| Molecular Weight | 596.37 g/mol |
| Exact Mass | 596.09 |
| IUPAC Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F17NOS/c1-34(2,3)6-8(35)7-36-5-4-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h8,35H,4-7H2,1-3H3/q+1 |
| InChIKey | VRHKIYMPKNNKRY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.37 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|