C16H19ClF17NOS — CID 138394411
[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium chloride (PubChem CID 138394411) has the molecular formula C16H19ClF17NOS and a molecular weight of 631.82 g/mol. Its IUPAC name is [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium chloride.
| Compound Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 138394411 |
| Molecular Formula | C16H19ClF17NOS |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.06 |
| IUPAC Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-hydroxypropyl]-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CC(O)CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C16H19F17NOS.ClH/c1-34(2,3)6-8(35)7-36-5-4-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33;/h8,35H,4-7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | YTRFCRLBSNMJOB-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|