C18H28O3S — CID 138394953
4-[(Z)-dodec-6-enyl]benzenesulfonic acid (PubChem CID 138394953) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is 4-[(Z)-dodec-6-enyl]benzenesulfonic acid.
| Compound Name | 4-[(Z)-dodec-6-enyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 138394953 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-[(Z)-dodec-6-enyl]benzenesulfonic acid |
| SMILES | CCCCC/C=C\CCCCCc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H28O3S/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(16-14-17)22(19,20)21/h6-7,13-16H,2-5,8-12H2,1H3,(H,19,20,21)/b7-6- |
| InChIKey | GNUHSLHKUOXNTN-SREVYHEPSA-N |
| XLogP | 5.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|