C15H17F13NO6S2- — CID 138395022
2-methyl-2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propanoylamino]propane-1-sulfonate (PubChem CID 138395022) has the molecular formula C15H17F13NO6S2- and a molecular weight of 618.41 g/mol. Its IUPAC name is 2-methyl-2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propanoylamino]propane-1-sulfonate.
| Compound Name | 2-methyl-2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propanoylamino]propane-1-sulfonate |
|---|---|
| PubChem CID | 138395022 |
| Molecular Formula | C15H17F13NO6S2- |
| Molecular Weight | 618.41 g/mol |
| Exact Mass | 618.03 |
| IUPAC Name | 2-methyl-2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propanoylamino]propane-1-sulfonate |
| SMILES | CC(C)(CS(=O)(=O)[O-])NC(=O)CCS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H18F13NO6S2/c1-9(2,7-37(33,34)35)29-8(30)3-5-36(31,32)6-4-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h3-7H2,1-2H3,(H,29,30)(H,33,34,35)/p-1 |
| InChIKey | RZBHYDQKJKDSNP-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|