C11H6F9NOS — CID 138395047
(NE,S)-N-benzylidene-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide (PubChem CID 138395047) has the molecular formula C11H6F9NOS and a molecular weight of 371.22 g/mol. Its IUPAC name is (NE,S)-N-benzylidene-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide.
| Compound Name | (NE,S)-N-benzylidene-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
|---|---|
| PubChem CID | 138395047 |
| Molecular Formula | C11H6F9NOS |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | (NE,S)-N-benzylidene-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
| SMILES | O=[S@](/N=C/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6F9NOS/c12-8(13,10(16,17)18)9(14,15)11(19,20)23(22)21-6-7-4-2-1-3-5-7/h1-6H/b21-6+/t23-/m0/s1 |
| InChIKey | IPFAAVDLIDTUNL-JZLKGKFRSA-N |
| XLogP | 4.19 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|