C29H17F26NO — CID 138395074
[(2S)-pyrrolidin-2-yl]-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]methanol (PubChem CID 138395074) has the molecular formula C29H17F26NO and a molecular weight of 889.41 g/mol. Its IUPAC name is [(2S)-pyrrolidin-2-yl]-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]methanol.
| Compound Name | [(2S)-pyrrolidin-2-yl]-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]methanol |
|---|---|
| PubChem CID | 138395074 |
| Molecular Formula | C29H17F26NO |
| Molecular Weight | 889.41 g/mol |
| Exact Mass | 889.09 |
| IUPAC Name | [(2S)-pyrrolidin-2-yl]-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]methanol |
| SMILES | OC(c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)(c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C29H17F26NO/c30-18(31,20(34,35)22(38,39)24(42,43)26(46,47)28(50,51)52)14-7-3-12(4-8-14)17(57,16-2-1-11-56-16)13-5-9-15(10-6-13)19(32,33)21(36,37)23(40,41)25(44,45)27(48,49)29(53,54)55/h3-10,16,56-57H,1-2,11H2/t16-/m0/s1 |
| InChIKey | ICXAVRGKJJLQDO-INIZCTEOSA-N |
| XLogP | 11.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.41 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|