C26H37F13O2 — CID 138395096
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl (Z)-octadec-9-enoate (PubChem CID 138395096) has the molecular formula C26H37F13O2 and a molecular weight of 628.55 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl (Z)-octadec-9-enoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 138395096 |
| Molecular Formula | C26H37F13O2 |
| Molecular Weight | 628.55 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H37F13O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(40)41-19-18-21(27,28)22(29,30)23(31,32)24(33,34)25(35,36)26(37,38)39/h9-10H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | VQLCZXOPOODRDY-KTKRTIGZSA-N |
| XLogP | 10.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.55 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|