About 4-methylmorpholine;(E)-octadec-9-enoic acid
4-methylmorpholine;(E)-octadec-9-enoic acid (PubChem CID 138395246) has the molecular formula C23H45NO3
and a molecular weight of 383.62 g/mol. Its IUPAC name is 4-methylmorpholine;(E)-octadec-9-enoic acid.
Molecular Properties
| Compound Name | 4-methylmorpholine;(E)-octadec-9-enoic acid |
| PubChem CID | 138395246 |
| Molecular Formula | C23H45NO3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.34 |
| IUPAC Name | 4-methylmorpholine;(E)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)O.CN1CCOCC1 |
| InChI | InChI=1S/C18H34O2.C5H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6-2-4-7-5-3-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-5H2,1H3/b10-9+; |
| InChIKey | MSDQEXGSUVJLKG-RRABGKBLSA-N |
| XLogP | 6.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylmorpholine;(E)-octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylmorpholine;(E)-octadec-9-enoic acid?
The IUPAC name of 4-methylmorpholine;(E)-octadec-9-enoic acid (CID 138395246) is 4-methylmorpholine;(E)-octadec-9-enoic acid.
What is the SMILES notation for 4-methylmorpholine;(E)-octadec-9-enoic acid?
The canonical SMILES for 4-methylmorpholine;(E)-octadec-9-enoic acid is CCCCCCCC/C=C/CCCCCCCC(=O)O.CN1CCOCC1.
What is the InChIKey of 4-methylmorpholine;(E)-octadec-9-enoic acid?
The InChIKey is MSDQEXGSUVJLKG-RRABGKBLSA-N. The full InChI is InChI=1S/C18H34O2.C5H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6-2-4-7-5-3-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-5H2,1H3/b10-9+;.
What are the key properties of 4-methylmorpholine;(E)-octadec-9-enoic acid?
4-methylmorpholine;(E)-octadec-9-enoic acid has a molecular weight of 383.62 g/mol, XLogP of 6.06, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylmorpholine;(E)-octadec-9-enoic acid is sourced from PubChem (CID 138395246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).