C8F18O — CID 138395750
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane (PubChem CID 138395750) has the molecular formula C8F18O and a molecular weight of 454.05 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane |
|---|---|
| PubChem CID | 138395750 |
| Molecular Formula | C8F18O |
| Molecular Weight | 454.05 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane |
| SMILES | FC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F18O/c9-1(10,3(13,14)5(17,18)19)2(11,12)4(15,16)7(23,24)27-8(25,26)6(20,21)22 |
| InChIKey | YMQHIOLQSRSEFT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.05 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|