C40H30N3NaO8S2 — CID 138395758
sodium 2-hydroxy-5-[[4-[[4-(4-hydroxy-3-sulfoanilino)phenyl]-(1-methyl-2-phenylindol-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino]benzenesulfonate (PubChem CID 138395758) has the molecular formula C40H30N3NaO8S2 and a molecular weight of 767.82 g/mol. Its IUPAC name is sodium 2-hydroxy-5-[[4-[[4-(4-hydroxy-3-sulfoanilino)phenyl]-(1-methyl-2-phenylindol-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino]benzenesulfonate.
| Compound Name | sodium 2-hydroxy-5-[[4-[[4-(4-hydroxy-3-sulfoanilino)phenyl]-(1-methyl-2-phenylindol-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino]benzenesulfonate |
|---|---|
| PubChem CID | 138395758 |
| Molecular Formula | C40H30N3NaO8S2 |
| Molecular Weight | 767.82 g/mol |
| Exact Mass | 767.14 |
| IUPAC Name | sodium 2-hydroxy-5-[[4-[[4-(4-hydroxy-3-sulfoanilino)phenyl]-(1-methyl-2-phenylindol-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino]benzenesulfonate |
| SMILES | Cn1c(-c2ccccc2)c(C(=C2C=CC(=Nc3ccc(O)c(S(=O)(=O)[O-])c3)C=C2)c2ccc(Nc3ccc(O)c(S(=O)(=O)O)c3)cc2)c2ccccc21.[Na+] |
| InChI | InChI=1S/C40H31N3O8S2.Na/c1-43-33-10-6-5-9-32(33)39(40(43)27-7-3-2-4-8-27)38(25-11-15-28(16-12-25)41-30-19-21-34(44)36(23-30)52(46,47)48)26-13-17-29(18-14-26)42-31-20-22-35(45)37(24-31)53(49,50)51;/h2-24,41,44-45H,1H3,(H,46,47,48)(H,49,50,51);/q;+1/p-1/b38-26-,42-29+; |
| InChIKey | WYGXRAJPLKXGEM-PCPLBKFMSA-M |
| XLogP | 4.86 |
| TPSA | 181.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|