About 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate
2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate (PubChem CID 138395767) has the molecular formula C13H10Br2N2O4S
and a molecular weight of 450.11 g/mol. Its IUPAC name is 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate |
| PubChem CID | 138395767 |
| Molecular Formula | C13H10Br2N2O4S |
| Molecular Weight | 450.11 g/mol |
| Exact Mass | 447.87 |
| IUPAC Name | 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate |
| SMILES | [N-]=[N+]=C1C=Cc2c(cccc2S(=O)(=O)OCC(Br)CBr)C1=O |
| InChI | InChI=1S/C13H10Br2N2O4S/c14-6-8(15)7-21-22(19,20)12-3-1-2-10-9(12)4-5-11(17-16)13(10)18/h1-5,8H,6-7H2 |
| InChIKey | QPDJAIAXLQDVMI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate?
The IUPAC name of 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate (CID 138395767) is 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate.
What is the SMILES notation for 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate?
The canonical SMILES for 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate is [N-]=[N+]=C1C=Cc2c(cccc2S(=O)(=O)OCC(Br)CBr)C1=O.
What is the InChIKey of 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate?
The InChIKey is QPDJAIAXLQDVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Br2N2O4S/c14-6-8(15)7-21-22(19,20)12-3-1-2-10-9(12)4-5-11(17-16)13(10)18/h1-5,8H,6-7H2.
What are the key properties of 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate?
2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate has a molecular weight of 450.11 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromopropyl (6Z)-6-diazo-5-oxonaphthalene-1-sulfonate is sourced from PubChem (CID 138395767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).