About ethoxy-nona-2,6-dienoxy-oxosilane
ethoxy-nona-2,6-dienoxy-oxosilane (PubChem CID 138395835) has the molecular formula C11H20O3Si
and a molecular weight of 228.36 g/mol. Its IUPAC name is ethoxy-nona-2,6-dienoxy-oxosilane.
Molecular Properties
| Compound Name | ethoxy-nona-2,6-dienoxy-oxosilane |
| PubChem CID | 138395835 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | ethoxy-nona-2,6-dienoxy-oxosilane |
| SMILES | CCC=CCCC=CCO[Si](=O)OCC |
| InChI | InChI=1S/C11H20O3Si/c1-3-5-6-7-8-9-10-11-14-15(12)13-4-2/h5-6,9-10H,3-4,7-8,11H2,1-2H3 |
| InChIKey | LOQMDKPWKKVYJB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethoxy-nona-2,6-dienoxy-oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy-nona-2,6-dienoxy-oxosilane?
The IUPAC name of ethoxy-nona-2,6-dienoxy-oxosilane (CID 138395835) is ethoxy-nona-2,6-dienoxy-oxosilane.
What is the SMILES notation for ethoxy-nona-2,6-dienoxy-oxosilane?
The canonical SMILES for ethoxy-nona-2,6-dienoxy-oxosilane is CCC=CCCC=CCO[Si](=O)OCC.
What is the InChIKey of ethoxy-nona-2,6-dienoxy-oxosilane?
The InChIKey is LOQMDKPWKKVYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3Si/c1-3-5-6-7-8-9-10-11-14-15(12)13-4-2/h5-6,9-10H,3-4,7-8,11H2,1-2H3.
What are the key properties of ethoxy-nona-2,6-dienoxy-oxosilane?
ethoxy-nona-2,6-dienoxy-oxosilane has a molecular weight of 228.36 g/mol, XLogP of 2.76, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-nona-2,6-dienoxy-oxosilane is sourced from PubChem (CID 138395835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).