C46H90N4O8S2 — CID 138395956
2-heptadec-8-enyl-1-[2-(2-heptadec-8-enyl-3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethyl]-3-methyl-4,5-dihydroimidazol-3-ium;methyl sulfate (PubChem CID 138395956) has the molecular formula C46H90N4O8S2 and a molecular weight of 891.38 g/mol. Its IUPAC name is 2-heptadec-8-enyl-1-[2-(2-heptadec-8-enyl-3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethyl]-3-methyl-4,5-dihydroimidazol-3-ium;methyl sulfate.
| Compound Name | 2-heptadec-8-enyl-1-[2-(2-heptadec-8-enyl-3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethyl]-3-methyl-4,5-dihydroimidazol-3-ium;methyl sulfate |
|---|---|
| PubChem CID | 138395956 |
| Molecular Formula | C46H90N4O8S2 |
| Molecular Weight | 891.38 g/mol |
| Exact Mass | 890.62 |
| IUPAC Name | 2-heptadec-8-enyl-1-[2-(2-heptadec-8-enyl-3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethyl]-3-methyl-4,5-dihydroimidazol-3-ium;methyl sulfate |
| SMILES | CCCCCCCCC=CCCCCCCCC1=[N+](C)CCN1CCN1CC[N+](C)=C1CCCCCCCC=CCCCCCCCC.COS(=O)(=O)[O-].COS(=O)(=O)[O-] |
| InChI | InChI=1S/C44H84N4.2CH4O4S/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-43-45(3)37-39-47(43)41-42-48-40-38-46(4)44(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;2*1-5-6(2,3)4/h19-22H,5-18,23-42H2,1-4H3;2*1H3,(H,2,3,4)/q+2;;/p-2 |
| InChIKey | DYCICMASTGMAMN-UHFFFAOYSA-L |
| XLogP | 9.96 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.38 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|