About 10-deuteriophenoxazine
10-deuteriophenoxazine (PubChem CID 138396006) has the molecular formula C12H9NO
and a molecular weight of 184.22 g/mol. Its IUPAC name is 10-deuteriophenoxazine.
Molecular Properties
| Compound Name | 10-deuteriophenoxazine |
| PubChem CID | 138396006 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 10-deuteriophenoxazine |
| SMILES | [2H]N1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H/i/hD |
| InChIKey | TZMSYXZUNZXBOL-DYCDLGHISA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-deuteriophenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-deuteriophenoxazine?
The IUPAC name of 10-deuteriophenoxazine (CID 138396006) is 10-deuteriophenoxazine.
What is the SMILES notation for 10-deuteriophenoxazine?
The canonical SMILES for 10-deuteriophenoxazine is [2H]N1c2ccccc2Oc2ccccc21.
What is the InChIKey of 10-deuteriophenoxazine?
The InChIKey is TZMSYXZUNZXBOL-DYCDLGHISA-N. The full InChI is InChI=1S/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H/i/hD.
What are the key properties of 10-deuteriophenoxazine?
10-deuteriophenoxazine has a molecular weight of 184.22 g/mol, XLogP of 3.54, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-deuteriophenoxazine is sourced from PubChem (CID 138396006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).