C14F26 — CID 138396244
1,1,1,3,4,5,5,6,6,7,8,10,10,10-tetradecafluoro-2,2,9,9-tetrakis(trifluoromethyl)deca-3,7-diene (PubChem CID 138396244) has the molecular formula C14F26 and a molecular weight of 662.10 g/mol. Its IUPAC name is 1,1,1,3,4,5,5,6,6,7,8,10,10,10-tetradecafluoro-2,2,9,9-tetrakis(trifluoromethyl)deca-3,7-diene.
| Compound Name | 1,1,1,3,4,5,5,6,6,7,8,10,10,10-tetradecafluoro-2,2,9,9-tetrakis(trifluoromethyl)deca-3,7-diene |
|---|---|
| PubChem CID | 138396244 |
| Molecular Formula | C14F26 |
| Molecular Weight | 662.10 g/mol |
| Exact Mass | 661.96 |
| IUPAC Name | 1,1,1,3,4,5,5,6,6,7,8,10,10,10-tetradecafluoro-2,2,9,9-tetrakis(trifluoromethyl)deca-3,7-diene |
| SMILES | FC(=C(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)=C(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14F26/c15-1(5(9(23,24)25,10(26,27)28)11(29,30)31)3(17)7(19,20)8(21,22)4(18)2(16)6(12(32,33)34,13(35,36)37)14(38,39)40 |
| InChIKey | AVAVXFBRAQABKB-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.10 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|