C19H24F17N2O12S3+ — CID 138396249
carboxymethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propyl]-bis(2-hydroxy-3-sulfopropyl)azanium (PubChem CID 138396249) has the molecular formula C19H24F17N2O12S3+ and a molecular weight of 891.57 g/mol. Its IUPAC name is carboxymethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propyl]-bis(2-hydroxy-3-sulfopropyl)azanium.
| Compound Name | carboxymethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propyl]-bis(2-hydroxy-3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 138396249 |
| Molecular Formula | C19H24F17N2O12S3+ |
| Molecular Weight | 891.57 g/mol |
| Exact Mass | 891.02 |
| IUPAC Name | carboxymethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propyl]-bis(2-hydroxy-3-sulfopropyl)azanium |
| SMILES | O=C(O)C[N+](CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CC(O)CS(=O)(=O)O)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C19H23F17N2O12S3/c20-12(21,14(24,25)16(28,29)18(32,33)34)13(22,23)15(26,27)17(30,31)19(35,36)53(49,50)37-2-1-3-38(6-11(41)42,4-9(39)7-51(43,44)45)5-10(40)8-52(46,47)48/h9-10,37,39-40H,1-8H2,(H2-,41,42,43,44,45,46,47,48)/p+1 |
| InChIKey | WPZMGBBXNMQYST-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 232.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.57 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|