C14H13F15 — CID 138396311
8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentadecafluorotetradec-6-ene (PubChem CID 138396311) has the molecular formula C14H13F15 and a molecular weight of 466.23 g/mol. Its IUPAC name is 8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentadecafluorotetradec-6-ene.
| Compound Name | 8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentadecafluorotetradec-6-ene |
|---|---|
| PubChem CID | 138396311 |
| Molecular Formula | C14H13F15 |
| Molecular Weight | 466.23 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentadecafluorotetradec-6-ene |
| SMILES | CCCCCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F15/c1-2-3-4-5-6-7-8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29/h6-7H,2-5H2,1H3 |
| InChIKey | AEYWRUOLWSDNSX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.23 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|