C15H14F19NO — CID 138396357
1-(butan-2-ylamino)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecan-2-ol (PubChem CID 138396357) has the molecular formula C15H14F19NO and a molecular weight of 585.25 g/mol. Its IUPAC name is 1-(butan-2-ylamino)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecan-2-ol.
| Compound Name | 1-(butan-2-ylamino)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecan-2-ol |
|---|---|
| PubChem CID | 138396357 |
| Molecular Formula | C15H14F19NO |
| Molecular Weight | 585.25 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | 1-(butan-2-ylamino)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecan-2-ol |
| SMILES | CCC(C)NCC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F19NO/c1-3-5(2)35-4-6(36)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)34/h5-6,35-36H,3-4H2,1-2H3 |
| InChIKey | PBRMQLWBNAZWRE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.25 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|