C19H14F17NO5 — CID 138396378
[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-methoxy-2-nitrophenyl]methanol (PubChem CID 138396378) has the molecular formula C19H14F17NO5 and a molecular weight of 659.29 g/mol. Its IUPAC name is [4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-methoxy-2-nitrophenyl]methanol.
| Compound Name | [4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-methoxy-2-nitrophenyl]methanol |
|---|---|
| PubChem CID | 138396378 |
| Molecular Formula | C19H14F17NO5 |
| Molecular Weight | 659.29 g/mol |
| Exact Mass | 659.06 |
| IUPAC Name | [4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-methoxy-2-nitrophenyl]methanol |
| SMILES | COc1cc(CO)c([N+](=O)[O-])cc1OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H14F17NO5/c1-41-10-5-8(7-38)9(37(39)40)6-11(10)42-4-2-3-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h5-6,38H,2-4,7H2,1H3 |
| InChIKey | QKLWGHXFCGPZDZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.29 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|