C9H2F17I — CID 138396386
1,1,1,2,3,3,5,5,7,7,7-undecafluoro-6-iodo-2,4-bis(trifluoromethyl)heptane (PubChem CID 138396386) has the molecular formula C9H2F17I and a molecular weight of 559.98 g/mol. Its IUPAC name is 1,1,1,2,3,3,5,5,7,7,7-undecafluoro-6-iodo-2,4-bis(trifluoromethyl)heptane.
| Compound Name | 1,1,1,2,3,3,5,5,7,7,7-undecafluoro-6-iodo-2,4-bis(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 138396386 |
| Molecular Formula | C9H2F17I |
| Molecular Weight | 559.98 g/mol |
| Exact Mass | 559.89 |
| IUPAC Name | 1,1,1,2,3,3,5,5,7,7,7-undecafluoro-6-iodo-2,4-bis(trifluoromethyl)heptane |
| SMILES | FC(F)(F)C(I)C(F)(F)C(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H2F17I/c10-3(11,2(27)6(17,18)19)1(5(14,15)16)4(12,13)7(20,8(21,22)23)9(24,25)26/h1-2H |
| InChIKey | POLHUHLCNCEPRS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.98 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|