C8H3ClF7N — CID 138396390
2-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine (PubChem CID 138396390) has the molecular formula C8H3ClF7N and a molecular weight of 281.56 g/mol. Its IUPAC name is 2-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine.
| Compound Name | 2-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine |
|---|---|
| PubChem CID | 138396390 |
| Molecular Formula | C8H3ClF7N |
| Molecular Weight | 281.56 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 2-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine |
| SMILES | FC(F)(F)C(F)(c1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C8H3ClF7N/c9-5-2-1-4(3-17-5)6(10,7(11,12)13)8(14,15)16/h1-3H |
| InChIKey | FGWMYARQPFCFQW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|