C15H15F7O2S — CID 138396399
3-butan-2-ylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid (PubChem CID 138396399) has the molecular formula C15H15F7O2S and a molecular weight of 392.34 g/mol. Its IUPAC name is 3-butan-2-ylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid.
| Compound Name | 3-butan-2-ylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 138396399 |
| Molecular Formula | C15H15F7O2S |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-butan-2-ylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid |
| SMILES | CCC(C)Sc1c(C(F)(C(F)(F)F)C(F)(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C15H15F7O2S/c1-4-7(2)25-11-8(3)9(12(23)24)5-6-10(11)13(16,14(17,18)19)15(20,21)22/h5-7H,4H2,1-3H3,(H,23,24) |
| InChIKey | DMUDOWYIYPORNE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |