C11F12O2 — CID 138396418
3,4,5,6,7-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-benzofuran-1-one (PubChem CID 138396418) has the molecular formula C11F12O2 and a molecular weight of 392.10 g/mol. Its IUPAC name is 3,4,5,6,7-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-benzofuran-1-one.
| Compound Name | 3,4,5,6,7-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 138396418 |
| Molecular Formula | C11F12O2 |
| Molecular Weight | 392.10 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 3,4,5,6,7-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-benzofuran-1-one |
| SMILES | O=C1OC(F)(C(F)(C(F)(F)F)C(F)(F)F)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C11F12O2/c12-3-1-2(4(13)6(15)5(3)14)8(16,25-7(1)24)9(17,10(18,19)20)11(21,22)23 |
| InChIKey | CMFLJSVAFTYJOM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|