C8H8F9NaO3S — CID 138396473
sodium 5,5,6,6,7,7,8,8,8-nonafluorooctane-1-sulfonate (PubChem CID 138396473) has the molecular formula C8H8F9NaO3S and a molecular weight of 378.19 g/mol. Its IUPAC name is sodium 5,5,6,6,7,7,8,8,8-nonafluorooctane-1-sulfonate.
| Compound Name | sodium 5,5,6,6,7,7,8,8,8-nonafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 138396473 |
| Molecular Formula | C8H8F9NaO3S |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | sodium 5,5,6,6,7,7,8,8,8-nonafluorooctane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8H9F9O3S.Na/c9-5(10,3-1-2-4-21(18,19)20)6(11,12)7(13,14)8(15,16)17;/h1-4H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | VBSIKBLJSKBZIJ-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|