C22H20F17IN2O2 — CID 138396486
3-[[4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoyl]amino]propyl-trimethylazanium iodide (PubChem CID 138396486) has the molecular formula C22H20F17IN2O2 and a molecular weight of 794.28 g/mol. Its IUPAC name is 3-[[4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoyl]amino]propyl-trimethylazanium iodide.
| Compound Name | 3-[[4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoyl]amino]propyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 138396486 |
| Molecular Formula | C22H20F17IN2O2 |
| Molecular Weight | 794.28 g/mol |
| Exact Mass | 794.03 |
| IUPAC Name | 3-[[4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoyl]amino]propyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCCNC(=O)c1ccc(OC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)cc1.[I-] |
| InChI | InChI=1S/C22H19F17N2O2.HI/c1-41(2,3)10-4-9-40-15(42)11-5-7-12(8-6-11)43-14(18(25,26)27)13(16(23,19(28,29)30)20(31,32)33)17(24,21(34,35)36)22(37,38)39;/h5-8H,4,9-10H2,1-3H3;1H |
| InChIKey | KWTDUEMEIALFQP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|