C26H21F15O2 — CID 138396497
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl 4-[4-[(2S)-2-methylbutyl]phenyl]benzoate (PubChem CID 138396497) has the molecular formula C26H21F15O2 and a molecular weight of 650.42 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl 4-[4-[(2S)-2-methylbutyl]phenyl]benzoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl 4-[4-[(2S)-2-methylbutyl]phenyl]benzoate |
|---|---|
| PubChem CID | 138396497 |
| Molecular Formula | C26H21F15O2 |
| Molecular Weight | 650.42 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl 4-[4-[(2S)-2-methylbutyl]phenyl]benzoate |
| SMILES | CC[C@H](C)Cc1ccc(-c2ccc(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H21F15O2/c1-3-14(2)12-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19(42)43-13-20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)41/h4-11,14H,3,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | OSQAPZGHDQYVKC-AWEZNQCLSA-N |
| XLogP | 9.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.42 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|