About 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide
5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide (PubChem CID 138396998) has the molecular formula C17H20BrN3
and a molecular weight of 346.27 g/mol. Its IUPAC name is 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide.
Molecular Properties
| Compound Name | 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide |
| PubChem CID | 138396998 |
| Molecular Formula | C17H20BrN3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide |
| SMILES | Br.[H]/N=c1\ccc2c3ccc(N)cc3c(CC)n(CC)c-2c1 |
| InChI | InChI=1S/C17H19N3.BrH/c1-3-16-15-9-11(18)5-7-13(15)14-8-6-12(19)10-17(14)20(16)4-2;/h5-10,19H,3-4,18H2,1-2H3;1H/b19-12+; |
| InChIKey | SNCDNBOAGQYXIZ-NNTHFVATSA-N |
| XLogP | 3.97 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide?
The IUPAC name of 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide (CID 138396998) is 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide.
What is the SMILES notation for 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide?
The canonical SMILES for 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide is Br.[H]/N=c1\ccc2c3ccc(N)cc3c(CC)n(CC)c-2c1.
What is the InChIKey of 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide?
The InChIKey is SNCDNBOAGQYXIZ-NNTHFVATSA-N. The full InChI is InChI=1S/C17H19N3.BrH/c1-3-16-15-9-11(18)5-7-13(15)14-8-6-12(19)10-17(14)20(16)4-2;/h5-10,19H,3-4,18H2,1-2H3;1H/b19-12+;.
What are the key properties of 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide?
5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide has a molecular weight of 346.27 g/mol, XLogP of 3.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-3-iminophenanthridin-8-amine;hydrobromide is sourced from PubChem (CID 138396998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).