C15H23NNa2O15S — CID 138397006
disodium;(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-(1-oxidoethylideneamino)-3-sulfooxyoxan-4-yl]oxyoxane-2-carboxylate (PubChem CID 138397006) has the molecular formula C15H23NNa2O15S and a molecular weight of 535.39 g/mol. Its IUPAC name is disodium;(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-(1-oxidoethylideneamino)-3-sulfooxyoxan-4-yl]oxyoxane-2-carboxylate.
| Compound Name | disodium;(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-(1-oxidoethylideneamino)-3-sulfooxyoxan-4-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 138397006 |
| Molecular Formula | C15H23NNa2O15S |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | disodium;(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-(1-oxidoethylideneamino)-3-sulfooxyoxan-4-yl]oxyoxane-2-carboxylate |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](OS(=O)(=O)O)[C@H](O[C@@H]2O[C@@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)[C@H]1/N=C(/C)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C15H25NO15S.2Na/c1-4(18)16-6-11(10(31-32(24,25)26)5(3-17)28-14(6)27-2)29-15-9(21)7(19)8(20)12(30-15)13(22)23;;/h5-12,14-15,17,19-21H,3H2,1-2H3,(H,16,18)(H,22,23)(H,24,25,26);;/q;2*+1/p-2/t5-,6-,7+,8+,9-,10+,11-,12-,14-,15-;;/m1../s1 |
| InChIKey | VFJHIBOVYWZXEM-HYGAWUOQSA-L |
| XLogP | -12.36 |
| TPSA | 256.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | -12.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|