About lithium;5-methylidenecyclohexa-1,3-diene;oxolane
lithium;5-methylidenecyclohexa-1,3-diene;oxolane (PubChem CID 138397334) has the molecular formula C11H15LiO
and a molecular weight of 170.18 g/mol. Its IUPAC name is lithium;5-methylidenecyclohexa-1,3-diene;oxolane.
Molecular Properties
| Compound Name | lithium;5-methylidenecyclohexa-1,3-diene;oxolane |
| PubChem CID | 138397334 |
| Molecular Formula | C11H15LiO |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | lithium;5-methylidenecyclohexa-1,3-diene;oxolane |
| SMILES | C1CCOC1.C=C1C=CC=C[CH-]1.[Li+] |
| InChI | InChI=1S/C7H7.C4H8O.Li/c1-7-5-3-2-4-6-7;1-2-4-5-3-1;/h2-6H,1H2;1-4H2;/q-1;;+1 |
| InChIKey | RJIKCBAUOLHCNL-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;5-methylidenecyclohexa-1,3-diene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;5-methylidenecyclohexa-1,3-diene;oxolane?
The IUPAC name of lithium;5-methylidenecyclohexa-1,3-diene;oxolane (CID 138397334) is lithium;5-methylidenecyclohexa-1,3-diene;oxolane.
What is the SMILES notation for lithium;5-methylidenecyclohexa-1,3-diene;oxolane?
The canonical SMILES for lithium;5-methylidenecyclohexa-1,3-diene;oxolane is C1CCOC1.C=C1C=CC=C[CH-]1.[Li+].
What is the InChIKey of lithium;5-methylidenecyclohexa-1,3-diene;oxolane?
The InChIKey is RJIKCBAUOLHCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C4H8O.Li/c1-7-5-3-2-4-6-7;1-2-4-5-3-1;/h2-6H,1H2;1-4H2;/q-1;;+1.
What are the key properties of lithium;5-methylidenecyclohexa-1,3-diene;oxolane?
lithium;5-methylidenecyclohexa-1,3-diene;oxolane has a molecular weight of 170.18 g/mol, XLogP of -0.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;5-methylidenecyclohexa-1,3-diene;oxolane is sourced from PubChem (CID 138397334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).