C9H11N2O9P-2 — CID 138397553
5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrimidine-2,4-diolate (PubChem CID 138397553) has the molecular formula C9H11N2O9P-2 and a molecular weight of 322.17 g/mol. Its IUPAC name is 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrimidine-2,4-diolate.
| Compound Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrimidine-2,4-diolate |
|---|---|
| PubChem CID | 138397553 |
| Molecular Formula | C9H11N2O9P-2 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrimidine-2,4-diolate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](c2cnc([O-])nc2[O-])[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H13N2O9P/c12-5-4(2-19-21(16,17)18)20-7(6(5)13)3-1-10-9(15)11-8(3)14/h1,4-7,12-13H,2H2,(H2,16,17,18)(H2,10,11,14,15)/p-2/t4-,5-,6-,7+/m1/s1 |
| InChIKey | MOBMOJGXNHLLIR-GBNDHIKLSA-L |
| XLogP | -3.11 |
| TPSA | 188.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|