About 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride
1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride (PubChem CID 138398218) has the molecular formula C14H25ClN2O
and a molecular weight of 272.82 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride |
| PubChem CID | 138398218 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride |
| SMILES | CC1=CC(C)C(=O)N(CCCN(C)C)C(C)=C1.Cl |
| InChI | InChI=1S/C14H24N2O.ClH/c1-11-9-12(2)14(17)16(13(3)10-11)8-6-7-15(4)5;/h9-10,12H,6-8H2,1-5H3;1H |
| InChIKey | SCJRVCGEYWPLAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride?
The IUPAC name of 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride (CID 138398218) is 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride.
What is the SMILES notation for 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride?
The canonical SMILES for 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride is CC1=CC(C)C(=O)N(CCCN(C)C)C(C)=C1.Cl.
What is the InChIKey of 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride?
The InChIKey is SCJRVCGEYWPLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O.ClH/c1-11-9-12(2)14(17)16(13(3)10-11)8-6-7-15(4)5;/h9-10,12H,6-8H2,1-5H3;1H.
What are the key properties of 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride?
1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride has a molecular weight of 272.82 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(dimethylamino)propyl]-3,5,7-trimethyl-3H-azepin-2-one;hydrochloride is sourced from PubChem (CID 138398218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).