About S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide
S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide (PubChem CID 138398282) has the molecular formula C10H15BrN2O2S
and a molecular weight of 307.21 g/mol. Its IUPAC name is S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide.
Molecular Properties
| Compound Name | S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide |
| PubChem CID | 138398282 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide |
| SMILES | Br.CC(=O)SCc1cnc(C)c(O)c1CN |
| InChI | InChI=1S/C10H14N2O2S.BrH/c1-6-10(14)9(3-11)8(4-12-6)5-15-7(2)13;/h4,14H,3,5,11H2,1-2H3;1H |
| InChIKey | JGKCCMMOAZUVLK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide?
The IUPAC name of S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide (CID 138398282) is S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide.
What is the SMILES notation for S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide?
The canonical SMILES for S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide is Br.CC(=O)SCc1cnc(C)c(O)c1CN.
What is the InChIKey of S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide?
The InChIKey is JGKCCMMOAZUVLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S.BrH/c1-6-10(14)9(3-11)8(4-12-6)5-15-7(2)13;/h4,14H,3,5,11H2,1-2H3;1H.
What are the key properties of S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide?
S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide has a molecular weight of 307.21 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl] ethanethioate;hydrobromide is sourced from PubChem (CID 138398282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).