C13H22ClN — CID 138398306
N,N-dimethyl-2,3,4,7,8,9-hexahydro-1H-benzo[7]annulen-9-amine;hydrochloride (PubChem CID 138398306) has the molecular formula C13H22ClN and a molecular weight of 227.78 g/mol. Its IUPAC name is N,N-dimethyl-2,3,4,7,8,9-hexahydro-1H-benzo[7]annulen-9-amine;hydrochloride.
| Compound Name | N,N-dimethyl-2,3,4,7,8,9-hexahydro-1H-benzo[7]annulen-9-amine;hydrochloride |
|---|---|
| PubChem CID | 138398306 |
| Molecular Formula | C13H22ClN |
| Molecular Weight | 227.78 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N,N-dimethyl-2,3,4,7,8,9-hexahydro-1H-benzo[7]annulen-9-amine;hydrochloride |
| SMILES | CN(C)C1CCC=CC2=C1CCCC2.Cl |
| InChI | InChI=1S/C13H21N.ClH/c1-14(2)13-10-6-4-8-11-7-3-5-9-12(11)13;/h4,8,13H,3,5-7,9-10H2,1-2H3;1H |
| InChIKey | ZUFMJVZMPFYAPX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |