C30H22O12 — CID 138398591
5,8,10,14,20,23,28-heptahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4,6,8,10,17(26),19,21,23-octaene-3,12,18,25,27-pentone (PubChem CID 138398591) has the molecular formula C30H22O12 and a molecular weight of 574.49 g/mol. Its IUPAC name is 5,8,10,14,20,23,28-heptahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4,6,8,10,17(26),19,21,23-octaene-3,12,18,25,27-pentone.
| Compound Name | 5,8,10,14,20,23,28-heptahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4,6,8,10,17(26),19,21,23-octaene-3,12,18,25,27-pentone |
|---|---|
| PubChem CID | 138398591 |
| Molecular Formula | C30H22O12 |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 5,8,10,14,20,23,28-heptahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4,6,8,10,17(26),19,21,23-octaene-3,12,18,25,27-pentone |
| SMILES | Cc1cc(O)c2c(c1O)C(=O)C1=C(C2=O)C(=O)C2C(O)C1C1C(O)CC(=O)C3=C(O)c4c(O)cc(C)c(O)c4C(=O)C321 |
| InChI | InChI=1S/C30H22O12/c1-6-3-8(31)12-16(22(6)35)25(38)14-15-19-10(33)5-11(34)20-26(39)13-9(32)4-7(2)23(36)18(13)29(42)30(19,20)21(27(15)40)28(41)17(14)24(12)37/h3-4,10,15,19,21,27,31-33,35-36,39-40H,5H2,1-2H3 |
| InChIKey | NYZUFCNQVDNNGN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 226.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|