About N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide
N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide (PubChem CID 138398988) has the molecular formula C18H23IN4O2
and a molecular weight of 454.31 g/mol. Its IUPAC name is N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide.
Molecular Properties
| Compound Name | N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide |
| PubChem CID | 138398988 |
| Molecular Formula | C18H23IN4O2 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide |
| SMILES | C[N+](C)(C)CCO/C([O-])=N/c1ccc(/N=N/c2ccccc2)cc1.I |
| InChI | InChI=1S/C18H22N4O2.HI/c1-22(2,3)13-14-24-18(23)19-15-9-11-17(12-10-15)21-20-16-7-5-4-6-8-16;/h4-12H,13-14H2,1-3H3;1H |
| InChIKey | CLDSCTOEEKXOSU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide?
The IUPAC name of N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide (CID 138398988) is N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide.
What is the SMILES notation for N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide?
The canonical SMILES for N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide is C[N+](C)(C)CCO/C([O-])=N/c1ccc(/N=N/c2ccccc2)cc1.I.
What is the InChIKey of N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide?
The InChIKey is CLDSCTOEEKXOSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2.HI/c1-22(2,3)13-14-24-18(23)19-15-9-11-17(12-10-15)21-20-16-7-5-4-6-8-16;/h4-12H,13-14H2,1-3H3;1H.
What are the key properties of N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide?
N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide has a molecular weight of 454.31 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-phenyldiazenylphenyl)-1-[2-(trimethylazaniumyl)ethoxy]methanimidate;hydroiodide is sourced from PubChem (CID 138398988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).