C9H9Cl4NO — CID 138399159
(4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methanamine;hydrochloride (PubChem CID 138399159) has the molecular formula C9H9Cl4NO and a molecular weight of 288.99 g/mol. Its IUPAC name is (4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methanamine;hydrochloride.
| Compound Name | (4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 138399159 |
| Molecular Formula | C9H9Cl4NO |
| Molecular Weight | 288.99 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | (4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methanamine;hydrochloride |
| SMILES | Cl.NCC1Cc2c(Cl)c(Cl)cc(Cl)c2O1 |
| InChI | InChI=1S/C9H8Cl3NO.ClH/c10-6-2-7(11)9-5(8(6)12)1-4(3-13)14-9;/h2,4H,1,3,13H2;1H |
| InChIKey | JJRYDBCZRWOMKF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.99 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|