About 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride
2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride (PubChem CID 138399247) has the molecular formula C14H21Cl2NO2S
and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride |
| PubChem CID | 138399247 |
| Molecular Formula | C14H21Cl2NO2S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)CSc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H20ClNO2S.ClH/c1-3-16(4-2)9-10-18-14(17)11-19-13-7-5-12(15)6-8-13;/h5-8H,3-4,9-11H2,1-2H3;1H |
| InChIKey | SGOFCKYJVQMSEE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride (CID 138399247) is 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride is CCN(CC)CCOC(=O)CSc1ccc(Cl)cc1.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride?
The InChIKey is SGOFCKYJVQMSEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO2S.ClH/c1-3-16(4-2)9-10-18-14(17)11-19-13-7-5-12(15)6-8-13;/h5-8H,3-4,9-11H2,1-2H3;1H.
What are the key properties of 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride?
2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride has a molecular weight of 338.30 g/mol, XLogP of 3.74, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-(4-chlorophenyl)sulfanylacetate;hydrochloride is sourced from PubChem (CID 138399247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).