About 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride
2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride (PubChem CID 138399280) has the molecular formula C20H30ClNO2
and a molecular weight of 351.92 g/mol. Its IUPAC name is 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride |
| PubChem CID | 138399280 |
| Molecular Formula | C20H30ClNO2 |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride |
| SMILES | CC1(c2ccccc2)CCC2(CC1)OCC(C1CCCCN1)O2.Cl |
| InChI | InChI=1S/C20H29NO2.ClH/c1-19(16-7-3-2-4-8-16)10-12-20(13-11-19)22-15-18(23-20)17-9-5-6-14-21-17;/h2-4,7-8,17-18,21H,5-6,9-15H2,1H3;1H |
| InChIKey | PMIFBJOMQOXWSL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The IUPAC name of 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride (CID 138399280) is 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride.
What is the SMILES notation for 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The canonical SMILES for 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride is CC1(c2ccccc2)CCC2(CC1)OCC(C1CCCCN1)O2.Cl.
What is the InChIKey of 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The InChIKey is PMIFBJOMQOXWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO2.ClH/c1-19(16-7-3-2-4-8-16)10-12-20(13-11-19)22-15-18(23-20)17-9-5-6-14-21-17;/h2-4,7-8,17-18,21H,5-6,9-15H2,1H3;1H.
What are the key properties of 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride has a molecular weight of 351.92 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methyl-8-phenyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride is sourced from PubChem (CID 138399280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).