C12H12CuF6N2O2 — CID 138399478
copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]ethylimino]pent-2-en-2-olate (PubChem CID 138399478) has the molecular formula C12H12CuF6N2O2 and a molecular weight of 393.77 g/mol. Its IUPAC name is copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]ethylimino]pent-2-en-2-olate.
| Compound Name | copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]ethylimino]pent-2-en-2-olate |
|---|---|
| PubChem CID | 138399478 |
| Molecular Formula | C12H12CuF6N2O2 |
| Molecular Weight | 393.77 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]ethylimino]pent-2-en-2-olate |
| SMILES | CC(/C=C(\[O-])C(F)(F)F)=N\CC/N=C(C)/C=C(\[O-])C(F)(F)F.[Cu+2] |
| InChI | InChI=1S/C12H14F6N2O2.Cu/c1-7(5-9(21)11(13,14)15)19-3-4-20-8(2)6-10(22)12(16,17)18;/h5-6,21-22H,3-4H2,1-2H3;/q;+2/p-2/b9-5-,10-6-,19-7+,20-8+; |
| InChIKey | LPBALYLNDZBXTP-UPPZCWFQSA-L |
| XLogP | 1.52 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.77 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|