C11H8O6 — CID 138399541
3,4,5,8-tetrahydroxy-7-methylnaphthalene-1,2-dione (PubChem CID 138399541) has the molecular formula C11H8O6 and a molecular weight of 236.18 g/mol. Its IUPAC name is 3,4,5,8-tetrahydroxy-7-methylnaphthalene-1,2-dione.
| Compound Name | 3,4,5,8-tetrahydroxy-7-methylnaphthalene-1,2-dione |
|---|---|
| PubChem CID | 138399541 |
| Molecular Formula | C11H8O6 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 3,4,5,8-tetrahydroxy-7-methylnaphthalene-1,2-dione |
| SMILES | Cc1cc(O)c2c(c1O)C(=O)C(=O)C(O)=C2O |
| InChI | InChI=1S/C11H8O6/c1-3-2-4(12)5-6(7(3)13)9(15)11(17)10(16)8(5)14/h2,12-14,16H,1H3 |
| InChIKey | IQPFXYNGRYHVKO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|