About N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide
N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide (PubChem CID 138399821) has the molecular formula C17H22HgI4N2S
and a molecular weight of 994.65 g/mol. Its IUPAC name is N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide.
Molecular Properties
| Compound Name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide |
| PubChem CID | 138399821 |
| Molecular Formula | C17H22HgI4N2S |
| Molecular Weight | 994.65 g/mol |
| Exact Mass | 995.74 |
| IUPAC Name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C.I.I.[Hg+2].[I-].[I-] |
| InChI | InChI=1S/C17H20N2S.Hg.4HI/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;;;;;/h4-11,13H,12H2,1-3H3;;4*1H/q;+2;;;;/p-2 |
| InChIKey | VIJNXISIZZXEGJ-UHFFFAOYSA-L |
| XLogP | -0.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 994.65 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide?
The IUPAC name of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide (CID 138399821) is N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide.
What is the SMILES notation for N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide?
The canonical SMILES for N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide is CC(CN1c2ccccc2Sc2ccccc21)N(C)C.I.I.[Hg+2].[I-].[I-].
What is the InChIKey of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide?
The InChIKey is VIJNXISIZZXEGJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H20N2S.Hg.4HI/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;;;;;/h4-11,13H,12H2,1-3H3;;4*1H/q;+2;;;;/p-2.
What are the key properties of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide?
N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide has a molecular weight of 994.65 g/mol, XLogP of -0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;mercury(2+);diiodide;dihydroiodide is sourced from PubChem (CID 138399821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).